C22H24F3N3O — CID 56517388
(Z)-4,4,4-trifluoro-N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]-3-phenylbut-2-enamide (PubChem CID 56517388) has the molecular formula C22H24F3N3O and a molecular weight of 403.45 g/mol. Its IUPAC name is (Z)-4,4,4-trifluoro-N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]-3-phenylbut-2-enamide.
| Compound Name | (Z)-4,4,4-trifluoro-N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]-3-phenylbut-2-enamide |
|---|---|
| PubChem CID | 56517388 |
| Molecular Formula | C22H24F3N3O |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | (Z)-4,4,4-trifluoro-N-[[2-(4-methylpiperazin-1-yl)phenyl]methyl]-3-phenylbut-2-enamide |
| SMILES | CN1CCN(c2ccccc2CNC(=O)/C=C(/c2ccccc2)C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H24F3N3O/c1-27-11-13-28(14-12-27)20-10-6-5-9-18(20)16-26-21(29)15-19(22(23,24)25)17-7-3-2-4-8-17/h2-10,15H,11-14,16H2,1H3,(H,26,29)/b19-15- |
| InChIKey | ZJJKSYBFPIDRAX-CYVLTUHYSA-N |
| XLogP | 3.70 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|