C22H25N5O4 — CID 56518542
4-methoxy-N-[2-[[4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)phenyl]carbamoylamino]ethyl]benzamide (PubChem CID 56518542) has the molecular formula C22H25N5O4 and a molecular weight of 423.47 g/mol. Its IUPAC name is 4-methoxy-N-[2-[[4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)phenyl]carbamoylamino]ethyl]benzamide.
| Compound Name | 4-methoxy-N-[2-[[4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)phenyl]carbamoylamino]ethyl]benzamide |
|---|---|
| PubChem CID | 56518542 |
| Molecular Formula | C22H25N5O4 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | 4-methoxy-N-[2-[[4-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)phenyl]carbamoylamino]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCNC(=O)Nc2ccc(-c3nc(C(C)C)no3)cc2)cc1 |
| InChI | InChI=1S/C22H25N5O4/c1-14(2)19-26-21(31-27-19)16-4-8-17(9-5-16)25-22(29)24-13-12-23-20(28)15-6-10-18(30-3)11-7-15/h4-11,14H,12-13H2,1-3H3,(H,23,28)(H2,24,25,29) |
| InChIKey | ROJYFBDYSGPRMO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|