About 2-(4-bromophenyl)sulfanyl-N'-(2,3,4-trifluorophenyl)propanehydrazide
2-(4-bromophenyl)sulfanyl-N'-(2,3,4-trifluorophenyl)propanehydrazide (PubChem CID 56519757) has the molecular formula C15H12BrF3N2OS
and a molecular weight of 405.24 g/mol. Its IUPAC name is 2-(4-bromophenyl)sulfanyl-N'-(2,3,4-trifluorophenyl)propanehydrazide.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)sulfanyl-N'-(2,3,4-trifluorophenyl)propanehydrazide |
| PubChem CID | 56519757 |
| Molecular Formula | C15H12BrF3N2OS |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 403.98 |
| IUPAC Name | 2-(4-bromophenyl)sulfanyl-N'-(2,3,4-trifluorophenyl)propanehydrazide |
| SMILES | CC(Sc1ccc(Br)cc1)C(=O)NNc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H12BrF3N2OS/c1-8(23-10-4-2-9(16)3-5-10)15(22)21-20-12-7-6-11(17)13(18)14(12)19/h2-8,20H,1H3,(H,21,22) |
| InChIKey | ZCSJGPSQQCLZHC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-bromophenyl)sulfanyl-N'-(2,3,4-trifluorophenyl)propanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)sulfanyl-N'-(2,3,4-trifluorophenyl)propanehydrazide?
The IUPAC name of 2-(4-bromophenyl)sulfanyl-N'-(2,3,4-trifluorophenyl)propanehydrazide (CID 56519757) is 2-(4-bromophenyl)sulfanyl-N'-(2,3,4-trifluorophenyl)propanehydrazide.
What is the SMILES notation for 2-(4-bromophenyl)sulfanyl-N'-(2,3,4-trifluorophenyl)propanehydrazide?
The canonical SMILES for 2-(4-bromophenyl)sulfanyl-N'-(2,3,4-trifluorophenyl)propanehydrazide is CC(Sc1ccc(Br)cc1)C(=O)NNc1ccc(F)c(F)c1F.
What is the InChIKey of 2-(4-bromophenyl)sulfanyl-N'-(2,3,4-trifluorophenyl)propanehydrazide?
The InChIKey is ZCSJGPSQQCLZHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BrF3N2OS/c1-8(23-10-4-2-9(16)3-5-10)15(22)21-20-12-7-6-11(17)13(18)14(12)19/h2-8,20H,1H3,(H,21,22).
What are the key properties of 2-(4-bromophenyl)sulfanyl-N'-(2,3,4-trifluorophenyl)propanehydrazide?
2-(4-bromophenyl)sulfanyl-N'-(2,3,4-trifluorophenyl)propanehydrazide has a molecular weight of 405.24 g/mol, XLogP of 4.49, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)sulfanyl-N'-(2,3,4-trifluorophenyl)propanehydrazide is sourced from PubChem (CID 56519757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).