C18H18F3N7O — CID 56520282
1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-N'-[3-(trifluoromethyl)phenyl]piperidine-4-carbohydrazide (PubChem CID 56520282) has the molecular formula C18H18F3N7O and a molecular weight of 405.38 g/mol. Its IUPAC name is 1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-N'-[3-(trifluoromethyl)phenyl]piperidine-4-carbohydrazide.
| Compound Name | 1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-N'-[3-(trifluoromethyl)phenyl]piperidine-4-carbohydrazide |
|---|---|
| PubChem CID | 56520282 |
| Molecular Formula | C18H18F3N7O |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1-([1,2,4]triazolo[4,3-b]pyridazin-6-yl)-N'-[3-(trifluoromethyl)phenyl]piperidine-4-carbohydrazide |
| SMILES | O=C(NNc1cccc(C(F)(F)F)c1)C1CCN(c2ccc3nncn3n2)CC1 |
| InChI | InChI=1S/C18H18F3N7O/c19-18(20,21)13-2-1-3-14(10-13)23-25-17(29)12-6-8-27(9-7-12)16-5-4-15-24-22-11-28(15)26-16/h1-5,10-12,23H,6-9H2,(H,25,29) |
| InChIKey | KGVAXGYWBNOYJE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|