C18H26N4O2S3 — CID 56520692
3-[[4-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]propane-1-sulfonamide (PubChem CID 56520692) has the molecular formula C18H26N4O2S3 and a molecular weight of 426.63 g/mol. Its IUPAC name is 3-[[4-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]propane-1-sulfonamide.
| Compound Name | 3-[[4-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 56520692 |
| Molecular Formula | C18H26N4O2S3 |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 3-[[4-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-5-thiophen-2-yl-1,2,4-triazol-3-yl]sulfanyl]propane-1-sulfonamide |
| SMILES | CC(C1CC2CCC1C2)n1c(SCCCS(N)(=O)=O)nnc1-c1cccs1 |
| InChI | InChI=1S/C18H26N4O2S3/c1-12(15-11-13-5-6-14(15)10-13)22-17(16-4-2-7-25-16)20-21-18(22)26-8-3-9-27(19,23)24/h2,4,7,12-15H,3,5-6,8-11H2,1H3,(H2,19,23,24) |
| InChIKey | UCVDUUOPXZHWEQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|