C22H29N3O3S — CID 56521199
N-(1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide (PubChem CID 56521199) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is N-(1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide.
| Compound Name | N-(1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 56521199 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-(1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl)-6-methyl-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
| SMILES | CC1CCc2[nH]c3c(C(=O)NC4CS(=O)(=O)CC4N4CCCC4)cccc3c2C1 |
| InChI | InChI=1S/C22H29N3O3S/c1-14-7-8-18-17(11-14)15-5-4-6-16(21(15)23-18)22(26)24-19-12-29(27,28)13-20(19)25-9-2-3-10-25/h4-6,14,19-20,23H,2-3,7-13H2,1H3,(H,24,26) |
| InChIKey | GGCJQLATYRCKKI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|