About N-(1,1-diphenylethyl)-2,3-dihydro-1-benzothiophene-2-carboxamide
N-(1,1-diphenylethyl)-2,3-dihydro-1-benzothiophene-2-carboxamide (PubChem CID 56522661) has the molecular formula C23H21NOS
and a molecular weight of 359.49 g/mol. Its IUPAC name is N-(1,1-diphenylethyl)-2,3-dihydro-1-benzothiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-(1,1-diphenylethyl)-2,3-dihydro-1-benzothiophene-2-carboxamide |
| PubChem CID | 56522661 |
| Molecular Formula | C23H21NOS |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-(1,1-diphenylethyl)-2,3-dihydro-1-benzothiophene-2-carboxamide |
| SMILES | CC(NC(=O)C1Cc2ccccc2S1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H21NOS/c1-23(18-11-4-2-5-12-18,19-13-6-3-7-14-19)24-22(25)21-16-17-10-8-9-15-20(17)26-21/h2-15,21H,16H2,1H3,(H,24,25) |
| InChIKey | LOHGHCUMVNTEEL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1,1-diphenylethyl)-2,3-dihydro-1-benzothiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1-diphenylethyl)-2,3-dihydro-1-benzothiophene-2-carboxamide?
The IUPAC name of N-(1,1-diphenylethyl)-2,3-dihydro-1-benzothiophene-2-carboxamide (CID 56522661) is N-(1,1-diphenylethyl)-2,3-dihydro-1-benzothiophene-2-carboxamide.
What is the SMILES notation for N-(1,1-diphenylethyl)-2,3-dihydro-1-benzothiophene-2-carboxamide?
The canonical SMILES for N-(1,1-diphenylethyl)-2,3-dihydro-1-benzothiophene-2-carboxamide is CC(NC(=O)C1Cc2ccccc2S1)(c1ccccc1)c1ccccc1.
What is the InChIKey of N-(1,1-diphenylethyl)-2,3-dihydro-1-benzothiophene-2-carboxamide?
The InChIKey is LOHGHCUMVNTEEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21NOS/c1-23(18-11-4-2-5-12-18,19-13-6-3-7-14-19)24-22(25)21-16-17-10-8-9-15-20(17)26-21/h2-15,21H,16H2,1H3,(H,24,25).
What are the key properties of N-(1,1-diphenylethyl)-2,3-dihydro-1-benzothiophene-2-carboxamide?
N-(1,1-diphenylethyl)-2,3-dihydro-1-benzothiophene-2-carboxamide has a molecular weight of 359.49 g/mol, XLogP of 4.78, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1-diphenylethyl)-2,3-dihydro-1-benzothiophene-2-carboxamide is sourced from PubChem (CID 56522661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).