C24H23NO3 — CID 56522786
2-(4-acetylphenoxy)-N-(1,1-diphenylethyl)acetamide (PubChem CID 56522786) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is 2-(4-acetylphenoxy)-N-(1,1-diphenylethyl)acetamide.
| Compound Name | 2-(4-acetylphenoxy)-N-(1,1-diphenylethyl)acetamide |
|---|---|
| PubChem CID | 56522786 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 2-(4-acetylphenoxy)-N-(1,1-diphenylethyl)acetamide |
| SMILES | CC(=O)c1ccc(OCC(=O)NC(C)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23NO3/c1-18(26)19-13-15-22(16-14-19)28-17-23(27)25-24(2,20-9-5-3-6-10-20)21-11-7-4-8-12-21/h3-16H,17H2,1-2H3,(H,25,27) |
| InChIKey | HUVNFELJJZNICZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |