C21H25NO — CID 56522804
2-cyclopentyl-N-(1,1-diphenylethyl)acetamide (PubChem CID 56522804) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is 2-cyclopentyl-N-(1,1-diphenylethyl)acetamide.
| Compound Name | 2-cyclopentyl-N-(1,1-diphenylethyl)acetamide |
|---|---|
| PubChem CID | 56522804 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 2-cyclopentyl-N-(1,1-diphenylethyl)acetamide |
| SMILES | CC(NC(=O)CC1CCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H25NO/c1-21(18-12-4-2-5-13-18,19-14-6-3-7-15-19)22-20(23)16-17-10-8-9-11-17/h2-7,12-15,17H,8-11,16H2,1H3,(H,22,23) |
| InChIKey | TVMUBBZOJKPQPF-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |