C25H26N2O2S — CID 56522986
N-(1,1-diphenylethyl)-1-(thiophene-2-carbonyl)piperidine-4-carboxamide (PubChem CID 56522986) has the molecular formula C25H26N2O2S and a molecular weight of 418.56 g/mol. Its IUPAC name is N-(1,1-diphenylethyl)-1-(thiophene-2-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(1,1-diphenylethyl)-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 56522986 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-(1,1-diphenylethyl)-1-(thiophene-2-carbonyl)piperidine-4-carboxamide |
| SMILES | CC(NC(=O)C1CCN(C(=O)c2cccs2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H26N2O2S/c1-25(20-9-4-2-5-10-20,21-11-6-3-7-12-21)26-23(28)19-14-16-27(17-15-19)24(29)22-13-8-18-30-22/h2-13,18-19H,14-17H2,1H3,(H,26,28) |
| InChIKey | YYBSZMHRYBJIRE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |