C22H26N4O4 — CID 56524435
4-(2-ethoxyphenoxy)-N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]butanamide (PubChem CID 56524435) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is 4-(2-ethoxyphenoxy)-N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]butanamide.
| Compound Name | 4-(2-ethoxyphenoxy)-N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]butanamide |
|---|---|
| PubChem CID | 56524435 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 4-(2-ethoxyphenoxy)-N-[[3-(4-methoxyphenyl)-1H-1,2,4-triazol-5-yl]methyl]butanamide |
| SMILES | CCOc1ccccc1OCCCC(=O)NCc1nc(-c2ccc(OC)cc2)n[nH]1 |
| InChI | InChI=1S/C22H26N4O4/c1-3-29-18-7-4-5-8-19(18)30-14-6-9-21(27)23-15-20-24-22(26-25-20)16-10-12-17(28-2)13-11-16/h4-5,7-8,10-13H,3,6,9,14-15H2,1-2H3,(H,23,27)(H,24,25,26) |
| InChIKey | XHHWOGJRUBGWDV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 98.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|