C25H24FN3O3 — CID 56524591
2-(3-fluoro-4-methoxyanilino)-1-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]ethanone (PubChem CID 56524591) has the molecular formula C25H24FN3O3 and a molecular weight of 433.48 g/mol. Its IUPAC name is 2-(3-fluoro-4-methoxyanilino)-1-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]ethanone.
| Compound Name | 2-(3-fluoro-4-methoxyanilino)-1-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 56524591 |
| Molecular Formula | C25H24FN3O3 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 2-(3-fluoro-4-methoxyanilino)-1-[3-(4-methoxyphenyl)-5-phenyl-3,4-dihydropyrazol-2-yl]ethanone |
| SMILES | COc1ccc(C2CC(c3ccccc3)=NN2C(=O)CNc2ccc(OC)c(F)c2)cc1 |
| InChI | InChI=1S/C25H24FN3O3/c1-31-20-11-8-18(9-12-20)23-15-22(17-6-4-3-5-7-17)28-29(23)25(30)16-27-19-10-13-24(32-2)21(26)14-19/h3-14,23,27H,15-16H2,1-2H3 |
| InChIKey | PFWHMIPBCHEFEM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|