C23H30N4O3 — CID 56524848
tert-butyl N-[1-[2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl]piperidin-4-yl]carbamate (PubChem CID 56524848) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is tert-butyl N-[1-[2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 56524848 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | tert-butyl N-[1-[2-[1-(2-cyanoethyl)indol-3-yl]-2-oxoethyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(CC(=O)c2cn(CCC#N)c3ccccc23)CC1 |
| InChI | InChI=1S/C23H30N4O3/c1-23(2,3)30-22(29)25-17-9-13-26(14-10-17)16-21(28)19-15-27(12-6-11-24)20-8-5-4-7-18(19)20/h4-5,7-8,15,17H,6,9-10,12-14,16H2,1-3H3,(H,25,29) |
| InChIKey | SCFRNTKKPFDQOL-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |