C19H25F4N7O — CID 56526018
2-N-(4-fluorophenyl)-6-[[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]methyl]-1,3,5-triazine-2,4-diamine (PubChem CID 56526018) has the molecular formula C19H25F4N7O and a molecular weight of 443.45 g/mol. Its IUPAC name is 2-N-(4-fluorophenyl)-6-[[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]methyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(4-fluorophenyl)-6-[[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]methyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 56526018 |
| Molecular Formula | C19H25F4N7O |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 2-N-(4-fluorophenyl)-6-[[4-[3-(2,2,2-trifluoroethoxy)propyl]piperazin-1-yl]methyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(CN2CCN(CCCOCC(F)(F)F)CC2)nc(Nc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C19H25F4N7O/c20-14-2-4-15(5-3-14)25-18-27-16(26-17(24)28-18)12-30-9-7-29(8-10-30)6-1-11-31-13-19(21,22)23/h2-5H,1,6-13H2,(H3,24,25,26,27,28) |
| InChIKey | VIVGIFUMFCIBRH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|