C18H23N5S — CID 56528107
5-(4-ethylphenyl)-3-(5-pyrazol-1-ylpentylsulfanyl)-1H-1,2,4-triazole (PubChem CID 56528107) has the molecular formula C18H23N5S and a molecular weight of 341.48 g/mol. Its IUPAC name is 5-(4-ethylphenyl)-3-(5-pyrazol-1-ylpentylsulfanyl)-1H-1,2,4-triazole.
| Compound Name | 5-(4-ethylphenyl)-3-(5-pyrazol-1-ylpentylsulfanyl)-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 56528107 |
| Molecular Formula | C18H23N5S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 5-(4-ethylphenyl)-3-(5-pyrazol-1-ylpentylsulfanyl)-1H-1,2,4-triazole |
| SMILES | CCc1ccc(-c2nc(SCCCCCn3cccn3)n[nH]2)cc1 |
| InChI | InChI=1S/C18H23N5S/c1-2-15-7-9-16(10-8-15)17-20-18(22-21-17)24-14-5-3-4-12-23-13-6-11-19-23/h6-11,13H,2-5,12,14H2,1H3,(H,20,21,22) |
| InChIKey | LOBYYCUQKHRZHT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|