About (2-chloro-3-pyridinyl)methyl 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-4-carboxylate
(2-chloro-3-pyridinyl)methyl 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-4-carboxylate (PubChem CID 56528153) has the molecular formula C19H18ClN3O4S
and a molecular weight of 419.89 g/mol. Its IUPAC name is (2-chloro-3-pyridinyl)methyl 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-4-carboxylate.
Molecular Properties
| Compound Name | (2-chloro-3-pyridinyl)methyl 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-4-carboxylate |
| PubChem CID | 56528153 |
| Molecular Formula | C19H18ClN3O4S |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | (2-chloro-3-pyridinyl)methyl 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-4-carboxylate |
| SMILES | O=C(OCc1cccnc1Cl)C1CCN(C2=NS(=O)(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C19H18ClN3O4S/c20-17-14(4-3-9-21-17)12-27-19(24)13-7-10-23(11-8-13)18-15-5-1-2-6-16(15)28(25,26)22-18/h1-6,9,13H,7-8,10-12H2 |
| InChIKey | GMUAXHMMGCVXLD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 88.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-3-pyridinyl)methyl 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-3-pyridinyl)methyl 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-4-carboxylate?
The IUPAC name of (2-chloro-3-pyridinyl)methyl 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-4-carboxylate (CID 56528153) is (2-chloro-3-pyridinyl)methyl 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-4-carboxylate.
What is the SMILES notation for (2-chloro-3-pyridinyl)methyl 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-4-carboxylate?
The canonical SMILES for (2-chloro-3-pyridinyl)methyl 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-4-carboxylate is O=C(OCc1cccnc1Cl)C1CCN(C2=NS(=O)(=O)c3ccccc32)CC1.
What is the InChIKey of (2-chloro-3-pyridinyl)methyl 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-4-carboxylate?
The InChIKey is GMUAXHMMGCVXLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClN3O4S/c20-17-14(4-3-9-21-17)12-27-19(24)13-7-10-23(11-8-13)18-15-5-1-2-6-16(15)28(25,26)22-18/h1-6,9,13H,7-8,10-12H2.
What are the key properties of (2-chloro-3-pyridinyl)methyl 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-4-carboxylate?
(2-chloro-3-pyridinyl)methyl 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-4-carboxylate has a molecular weight of 419.89 g/mol, XLogP of 2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-3-pyridinyl)methyl 1-(1,1-dioxo-1,2-benzothiazol-3-yl)piperidine-4-carboxylate is sourced from PubChem (CID 56528153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).