About 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 1-ethylindole-2-carboxylate
3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 1-ethylindole-2-carboxylate (PubChem CID 56528605) has the molecular formula C22H21N3O4
and a molecular weight of 391.43 g/mol. Its IUPAC name is 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 1-ethylindole-2-carboxylate.
Molecular Properties
| Compound Name | 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 1-ethylindole-2-carboxylate |
| PubChem CID | 56528605 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 1-ethylindole-2-carboxylate |
| SMILES | CCn1c(C(=O)OCCCn2c(=O)[nH]c3ccccc3c2=O)cc2ccccc21 |
| InChI | InChI=1S/C22H21N3O4/c1-2-24-18-11-6-3-8-15(18)14-19(24)21(27)29-13-7-12-25-20(26)16-9-4-5-10-17(16)23-22(25)28/h3-6,8-11,14H,2,7,12-13H2,1H3,(H,23,28) |
| InChIKey | RKLREHMKNRWYAR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 1-ethylindole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 1-ethylindole-2-carboxylate?
The IUPAC name of 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 1-ethylindole-2-carboxylate (CID 56528605) is 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 1-ethylindole-2-carboxylate.
What is the SMILES notation for 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 1-ethylindole-2-carboxylate?
The canonical SMILES for 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 1-ethylindole-2-carboxylate is CCn1c(C(=O)OCCCn2c(=O)[nH]c3ccccc3c2=O)cc2ccccc21.
What is the InChIKey of 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 1-ethylindole-2-carboxylate?
The InChIKey is RKLREHMKNRWYAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3O4/c1-2-24-18-11-6-3-8-15(18)14-19(24)21(27)29-13-7-12-25-20(26)16-9-4-5-10-17(16)23-22(25)28/h3-6,8-11,14H,2,7,12-13H2,1H3,(H,23,28).
What are the key properties of 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 1-ethylindole-2-carboxylate?
3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 1-ethylindole-2-carboxylate has a molecular weight of 391.43 g/mol, XLogP of 2.91, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,4-dioxo-1H-quinazolin-3-yl)propyl 1-ethylindole-2-carboxylate is sourced from PubChem (CID 56528605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).