C15H22N2O2Si — CID 56529154
5-ethyl-5-phenyl-3-(trimethylsilylmethyl)imidazolidine-2,4-dione (PubChem CID 56529154) has the molecular formula C15H22N2O2Si and a molecular weight of 290.44 g/mol. Its IUPAC name is 5-ethyl-5-phenyl-3-(trimethylsilylmethyl)imidazolidine-2,4-dione.
| Compound Name | 5-ethyl-5-phenyl-3-(trimethylsilylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 56529154 |
| Molecular Formula | C15H22N2O2Si |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 5-ethyl-5-phenyl-3-(trimethylsilylmethyl)imidazolidine-2,4-dione |
| SMILES | CCC1(c2ccccc2)NC(=O)N(C[Si](C)(C)C)C1=O |
| InChI | InChI=1S/C15H22N2O2Si/c1-5-15(12-9-7-6-8-10-12)13(18)17(14(19)16-15)11-20(2,3)4/h6-10H,5,11H2,1-4H3,(H,16,19) |
| InChIKey | MOHVHEDXZWIBIF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|