C11H10Cl2F3NO2S — CID 56529170
2,2,2-trifluoroethyl N-[2-(2,6-dichlorophenyl)sulfanylethyl]carbamate (PubChem CID 56529170) has the molecular formula C11H10Cl2F3NO2S and a molecular weight of 348.17 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[2-(2,6-dichlorophenyl)sulfanylethyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[2-(2,6-dichlorophenyl)sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 56529170 |
| Molecular Formula | C11H10Cl2F3NO2S |
| Molecular Weight | 348.17 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[2-(2,6-dichlorophenyl)sulfanylethyl]carbamate |
| SMILES | O=C(NCCSc1c(Cl)cccc1Cl)OCC(F)(F)F |
| InChI | InChI=1S/C11H10Cl2F3NO2S/c12-7-2-1-3-8(13)9(7)20-5-4-17-10(18)19-6-11(14,15)16/h1-3H,4-6H2,(H,17,18) |
| InChIKey | JLWAXKKBAIXGAV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.17 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|