C18H20F3N3O4S — CID 56529245
2,2,2-trifluoroethyl N-[2-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-ethylimidazol-2-yl]sulfanylethyl]carbamate (PubChem CID 56529245) has the molecular formula C18H20F3N3O4S and a molecular weight of 431.44 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[2-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-ethylimidazol-2-yl]sulfanylethyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[2-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-ethylimidazol-2-yl]sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 56529245 |
| Molecular Formula | C18H20F3N3O4S |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[2-[5-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-ethylimidazol-2-yl]sulfanylethyl]carbamate |
| SMILES | CCn1c(-c2ccc3c(c2)OCCO3)cnc1SCCNC(=O)OCC(F)(F)F |
| InChI | InChI=1S/C18H20F3N3O4S/c1-2-24-13(12-3-4-14-15(9-12)27-7-6-26-14)10-23-16(24)29-8-5-22-17(25)28-11-18(19,20)21/h3-4,9-10H,2,5-8,11H2,1H3,(H,22,25) |
| InChIKey | DWYZHIDMHRBQDV-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_5_A(8)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|