C16H22F3N5O2S — CID 56529675
2,2,2-trifluoroethyl N-[2-[(6-butyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]ethyl]carbamate (PubChem CID 56529675) has the molecular formula C16H22F3N5O2S and a molecular weight of 405.45 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[2-[(6-butyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]ethyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[2-[(6-butyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 56529675 |
| Molecular Formula | C16H22F3N5O2S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[2-[(6-butyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)sulfanyl]ethyl]carbamate |
| SMILES | CCCCc1c(C)nc2nc(SCCNC(=O)OCC(F)(F)F)nn2c1C |
| InChI | InChI=1S/C16H22F3N5O2S/c1-4-5-6-12-10(2)21-13-22-14(23-24(13)11(12)3)27-8-7-20-15(25)26-9-16(17,18)19/h4-9H2,1-3H3,(H,20,25) |
| InChIKey | KDWNXJNTIXXGOY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|