C16H17F3N4OSi — CID 56529698
1-[3-(trifluoromethyl)phenyl]-5-(trimethylsilylmethyl)pyrazolo[5,4-d]pyrimidin-4-one (PubChem CID 56529698) has the molecular formula C16H17F3N4OSi and a molecular weight of 366.42 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenyl]-5-(trimethylsilylmethyl)pyrazolo[5,4-d]pyrimidin-4-one.
| Compound Name | 1-[3-(trifluoromethyl)phenyl]-5-(trimethylsilylmethyl)pyrazolo[5,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 56529698 |
| Molecular Formula | C16H17F3N4OSi |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenyl]-5-(trimethylsilylmethyl)pyrazolo[5,4-d]pyrimidin-4-one |
| SMILES | C[Si](C)(C)Cn1cnc2c(cnn2-c2cccc(C(F)(F)F)c2)c1=O |
| InChI | InChI=1S/C16H17F3N4OSi/c1-25(2,3)10-22-9-20-14-13(15(22)24)8-21-23(14)12-6-4-5-11(7-12)16(17,18)19/h4-9H,10H2,1-3H3 |
| InChIKey | FLWOBILVOALFNU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|