C19H17N3O5 — CID 56530016
N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]-2-(4-nitrophenoxy)acetamide (PubChem CID 56530016) has the molecular formula C19H17N3O5 and a molecular weight of 367.36 g/mol. Its IUPAC name is N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 56530016 |
| Molecular Formula | C19H17N3O5 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-[3-(4-ethylphenyl)-1,2-oxazol-5-yl]-2-(4-nitrophenoxy)acetamide |
| SMILES | CCc1ccc(-c2cc(NC(=O)COc3ccc([N+](=O)[O-])cc3)on2)cc1 |
| InChI | InChI=1S/C19H17N3O5/c1-2-13-3-5-14(6-4-13)17-11-19(27-21-17)20-18(23)12-26-16-9-7-15(8-10-16)22(24)25/h3-11H,2,12H2,1H3,(H,20,23) |
| InChIKey | MEDZWIAJBUUFGJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|