C17H16ClN3O3 — CID 56531627
(4-chloro-2-methylphenyl) 2-(5,7-dimethyl-2-oxo-1H-pyrazolo[1,5-a]pyrimidin-6-yl)acetate (PubChem CID 56531627) has the molecular formula C17H16ClN3O3 and a molecular weight of 345.79 g/mol. Its IUPAC name is (4-chloro-2-methylphenyl) 2-(5,7-dimethyl-2-oxo-1H-pyrazolo[1,5-a]pyrimidin-6-yl)acetate.
| Compound Name | (4-chloro-2-methylphenyl) 2-(5,7-dimethyl-2-oxo-1H-pyrazolo[1,5-a]pyrimidin-6-yl)acetate |
|---|---|
| PubChem CID | 56531627 |
| Molecular Formula | C17H16ClN3O3 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | (4-chloro-2-methylphenyl) 2-(5,7-dimethyl-2-oxo-1H-pyrazolo[1,5-a]pyrimidin-6-yl)acetate |
| SMILES | Cc1cc(Cl)ccc1OC(=O)Cc1c(C)nc2cc(=O)[nH]n2c1C |
| InChI | InChI=1S/C17H16ClN3O3/c1-9-6-12(18)4-5-14(9)24-17(23)7-13-10(2)19-15-8-16(22)20-21(15)11(13)3/h4-6,8H,7H2,1-3H3,(H,20,22) |
| InChIKey | FRISKBMSBQHGQR-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|