C22H21ClN4O2 — CID 56531713
N-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)-5-chloro-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 56531713) has the molecular formula C22H21ClN4O2 and a molecular weight of 408.89 g/mol. Its IUPAC name is N-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)-5-chloro-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)-5-chloro-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 56531713 |
| Molecular Formula | C22H21ClN4O2 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | N-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)-5-chloro-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cc(C(C)(C)C)nn2-c2ccccn2)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C22H21ClN4O2/c1-13-15-11-14(23)8-9-16(15)29-20(13)21(28)25-19-12-17(22(2,3)4)26-27(19)18-7-5-6-10-24-18/h5-12H,1-4H3,(H,25,28) |
| InChIKey | FZWZBBZZUGRBAA-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |