C19H23N5O4S — CID 56531804
2-(5,7-dimethyl-2-oxo-1H-pyrazolo[1,5-a]pyrimidin-6-yl)-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide (PubChem CID 56531804) has the molecular formula C19H23N5O4S and a molecular weight of 417.49 g/mol. Its IUPAC name is 2-(5,7-dimethyl-2-oxo-1H-pyrazolo[1,5-a]pyrimidin-6-yl)-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide.
| Compound Name | 2-(5,7-dimethyl-2-oxo-1H-pyrazolo[1,5-a]pyrimidin-6-yl)-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 56531804 |
| Molecular Formula | C19H23N5O4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 2-(5,7-dimethyl-2-oxo-1H-pyrazolo[1,5-a]pyrimidin-6-yl)-N-[2-[(4-methylphenyl)sulfonylamino]ethyl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCNC(=O)Cc2c(C)nc3cc(=O)[nH]n3c2C)cc1 |
| InChI | InChI=1S/C19H23N5O4S/c1-12-4-6-15(7-5-12)29(27,28)21-9-8-20-18(25)10-16-13(2)22-17-11-19(26)23-24(17)14(16)3/h4-7,11,21H,8-10H2,1-3H3,(H,20,25)(H,23,26) |
| InChIKey | PWGPCSXNRCZGDO-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|