C22H26N8O2 — CID 56532371
5-cyano-5-(1,3-dimethylbenzimidazol-2-ylidene)-4-oxo-N-(3-piperidin-1-yl-1H-1,2,4-triazol-5-yl)pentanamide (PubChem CID 56532371) has the molecular formula C22H26N8O2 and a molecular weight of 434.50 g/mol. Its IUPAC name is 5-cyano-5-(1,3-dimethylbenzimidazol-2-ylidene)-4-oxo-N-(3-piperidin-1-yl-1H-1,2,4-triazol-5-yl)pentanamide.
| Compound Name | 5-cyano-5-(1,3-dimethylbenzimidazol-2-ylidene)-4-oxo-N-(3-piperidin-1-yl-1H-1,2,4-triazol-5-yl)pentanamide |
|---|---|
| PubChem CID | 56532371 |
| Molecular Formula | C22H26N8O2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 5-cyano-5-(1,3-dimethylbenzimidazol-2-ylidene)-4-oxo-N-(3-piperidin-1-yl-1H-1,2,4-triazol-5-yl)pentanamide |
| SMILES | CN1C(=C(C#N)C(=O)CCC(=O)Nc2nc(N3CCCCC3)n[nH]2)N(C)c2ccccc21 |
| InChI | InChI=1S/C22H26N8O2/c1-28-16-8-4-5-9-17(16)29(2)20(28)15(14-23)18(31)10-11-19(32)24-21-25-22(27-26-21)30-12-6-3-7-13-30/h4-5,8-9H,3,6-7,10-13H2,1-2H3,(H2,24,25,26,27,32) |
| InChIKey | JIWNVZUWIIXGPR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 121.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|