C20H21N5O2S2 — CID 56537571
(E)-N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide (PubChem CID 56537571) has the molecular formula C20H21N5O2S2 and a molecular weight of 427.56 g/mol. Its IUPAC name is (E)-N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 56537571 |
| Molecular Formula | C20H21N5O2S2 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | (E)-N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-[4-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
| SMILES | Cc1nc(COc2ccc(/C=C/C(=O)NCc3n[nH]c(=S)n3C3CC3)cc2)cs1 |
| InChI | InChI=1S/C20H21N5O2S2/c1-13-22-15(12-29-13)11-27-17-7-2-14(3-8-17)4-9-19(26)21-10-18-23-24-20(28)25(18)16-5-6-16/h2-4,7-9,12,16H,5-6,10-11H2,1H3,(H,21,26)(H,24,28)/b9-4+ |
| InChIKey | SLQQNERVPRBLJW-RUDMXATFSA-N |
| XLogP | 3.95 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|