C19H17FN4OS2 — CID 56537578
(E)-N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-[5-(4-fluorophenyl)thiophen-2-yl]prop-2-enamide (PubChem CID 56537578) has the molecular formula C19H17FN4OS2 and a molecular weight of 400.50 g/mol. Its IUPAC name is (E)-N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-[5-(4-fluorophenyl)thiophen-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-[5-(4-fluorophenyl)thiophen-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 56537578 |
| Molecular Formula | C19H17FN4OS2 |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | (E)-N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-[5-(4-fluorophenyl)thiophen-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccc(F)cc2)s1)NCc1n[nH]c(=S)n1C1CC1 |
| InChI | InChI=1S/C19H17FN4OS2/c20-13-3-1-12(2-4-13)16-9-7-15(27-16)8-10-18(25)21-11-17-22-23-19(26)24(17)14-5-6-14/h1-4,7-10,14H,5-6,11H2,(H,21,25)(H,23,26)/b10-8+ |
| InChIKey | ZCXBQHYOKQFDMP-CSKARUKUSA-N |
| XLogP | 4.47 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|