C25H31N5O — CID 56538244
2-(diethylamino)-2-phenyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]acetamide (PubChem CID 56538244) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is 2-(diethylamino)-2-phenyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]acetamide.
| Compound Name | 2-(diethylamino)-2-phenyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 56538244 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 2-(diethylamino)-2-phenyl-N-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)phenyl]acetamide |
| SMILES | CCN(CC)C(C(=O)Nc1cccc(-c2nnc3n2CCCCC3)c1)c1ccccc1 |
| InChI | InChI=1S/C25H31N5O/c1-3-29(4-2)23(19-12-7-5-8-13-19)25(31)26-21-15-11-14-20(18-21)24-28-27-22-16-9-6-10-17-30(22)24/h5,7-8,11-15,18,23H,3-4,6,9-10,16-17H2,1-2H3,(H,26,31) |
| InChIKey | BOHDWVJNDGFTBD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |