About methyl 3-ethenyl-2,5-dimethylhex-4-enoate
methyl 3-ethenyl-2,5-dimethylhex-4-enoate (PubChem CID 565394) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is methyl 3-ethenyl-2,5-dimethylhex-4-enoate.
Molecular Properties
| Compound Name | methyl 3-ethenyl-2,5-dimethylhex-4-enoate |
| PubChem CID | 565394 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | methyl 3-ethenyl-2,5-dimethylhex-4-enoate |
| SMILES | C=CC(C=C(C)C)C(C)C(=O)OC |
| InChI | InChI=1S/C11H18O2/c1-6-10(7-8(2)3)9(4)11(12)13-5/h6-7,9-10H,1H2,2-5H3 |
| InChIKey | QYFHCJWTWXQYQS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-ethenyl-2,5-dimethylhex-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-ethenyl-2,5-dimethylhex-4-enoate?
The IUPAC name of methyl 3-ethenyl-2,5-dimethylhex-4-enoate (CID 565394) is methyl 3-ethenyl-2,5-dimethylhex-4-enoate.
What is the SMILES notation for methyl 3-ethenyl-2,5-dimethylhex-4-enoate?
The canonical SMILES for methyl 3-ethenyl-2,5-dimethylhex-4-enoate is C=CC(C=C(C)C)C(C)C(=O)OC.
What is the InChIKey of methyl 3-ethenyl-2,5-dimethylhex-4-enoate?
The InChIKey is QYFHCJWTWXQYQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-6-10(7-8(2)3)9(4)11(12)13-5/h6-7,9-10H,1H2,2-5H3.
What are the key properties of methyl 3-ethenyl-2,5-dimethylhex-4-enoate?
methyl 3-ethenyl-2,5-dimethylhex-4-enoate has a molecular weight of 182.26 g/mol, XLogP of 2.56, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-ethenyl-2,5-dimethylhex-4-enoate is sourced from PubChem (CID 565394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).