About 1,2,3,4-tetramethylcyclobutene
1,2,3,4-tetramethylcyclobutene (PubChem CID 565395) has the molecular formula C8H14
and a molecular weight of 110.20 g/mol. Its IUPAC name is 1,2,3,4-tetramethylcyclobutene.
Molecular Properties
| Compound Name | 1,2,3,4-tetramethylcyclobutene |
| PubChem CID | 565395 |
| Molecular Formula | C8H14 |
| Molecular Weight | 110.20 g/mol |
| Exact Mass | 110.11 |
| IUPAC Name | 1,2,3,4-tetramethylcyclobutene |
| SMILES | CC1=C(C)C(C)C1C |
| InChI | InChI=1S/C8H14/c1-5-6(2)8(4)7(5)3/h5-6H,1-4H3 |
| InChIKey | YBYPDQPOSUFAHC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.20 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,2,3,4-tetramethylcyclobutene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3,4-tetramethylcyclobutene?
The IUPAC name of 1,2,3,4-tetramethylcyclobutene (CID 565395) is 1,2,3,4-tetramethylcyclobutene.
What is the SMILES notation for 1,2,3,4-tetramethylcyclobutene?
The canonical SMILES for 1,2,3,4-tetramethylcyclobutene is CC1=C(C)C(C)C1C.
What is the InChIKey of 1,2,3,4-tetramethylcyclobutene?
The InChIKey is YBYPDQPOSUFAHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14/c1-5-6(2)8(4)7(5)3/h5-6H,1-4H3.
What are the key properties of 1,2,3,4-tetramethylcyclobutene?
1,2,3,4-tetramethylcyclobutene has a molecular weight of 110.20 g/mol, XLogP of 2.61, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3,4-tetramethylcyclobutene is sourced from PubChem (CID 565395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).