C26H32N6O — CID 56540018
N-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-2-pyrrolidin-1-ylquinoline-3-carboxamide (PubChem CID 56540018) has the molecular formula C26H32N6O and a molecular weight of 444.58 g/mol. Its IUPAC name is N-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-2-pyrrolidin-1-ylquinoline-3-carboxamide.
| Compound Name | N-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-2-pyrrolidin-1-ylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 56540018 |
| Molecular Formula | C26H32N6O |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | N-[[6-(4-ethylpiperazin-1-yl)-3-pyridinyl]methyl]-2-pyrrolidin-1-ylquinoline-3-carboxamide |
| SMILES | CCN1CCN(c2ccc(CNC(=O)c3cc4ccccc4nc3N3CCCC3)cn2)CC1 |
| InChI | InChI=1S/C26H32N6O/c1-2-30-13-15-31(16-14-30)24-10-9-20(18-27-24)19-28-26(33)22-17-21-7-3-4-8-23(21)29-25(22)32-11-5-6-12-32/h3-4,7-10,17-18H,2,5-6,11-16,19H2,1H3,(H,28,33) |
| InChIKey | RVBUSZHDWABDGS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |