C21H16FN3O4S — CID 56542996
methyl 3-[[1-(4-fluorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carbonyl]amino]-2-hydroxybenzoate (PubChem CID 56542996) has the molecular formula C21H16FN3O4S and a molecular weight of 425.44 g/mol. Its IUPAC name is methyl 3-[[1-(4-fluorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carbonyl]amino]-2-hydroxybenzoate.
| Compound Name | methyl 3-[[1-(4-fluorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carbonyl]amino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 56542996 |
| Molecular Formula | C21H16FN3O4S |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | methyl 3-[[1-(4-fluorophenyl)-3-methylthieno[3,2-d]pyrazole-5-carbonyl]amino]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2cc3c(C)nn(-c4ccc(F)cc4)c3s2)c1O |
| InChI | InChI=1S/C21H16FN3O4S/c1-11-15-10-17(30-20(15)25(24-11)13-8-6-12(22)7-9-13)19(27)23-16-5-3-4-14(18(16)26)21(28)29-2/h3-10,26H,1-2H3,(H,23,27) |
| InChIKey | FMMVYXKQUKMNRL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|