C16H21BrN4O3S — CID 56543044
2-(2-bromo-4,5-diethoxyphenyl)-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]acetamide (PubChem CID 56543044) has the molecular formula C16H21BrN4O3S and a molecular weight of 429.34 g/mol. Its IUPAC name is 2-(2-bromo-4,5-diethoxyphenyl)-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]acetamide.
| Compound Name | 2-(2-bromo-4,5-diethoxyphenyl)-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 56543044 |
| Molecular Formula | C16H21BrN4O3S |
| Molecular Weight | 429.34 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 2-(2-bromo-4,5-diethoxyphenyl)-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]acetamide |
| SMILES | CCOc1cc(Br)c(CC(=O)NCc2n[nH]c(=S)n2C)cc1OCC |
| InChI | InChI=1S/C16H21BrN4O3S/c1-4-23-12-6-10(11(17)8-13(12)24-5-2)7-15(22)18-9-14-19-20-16(25)21(14)3/h6,8H,4-5,7,9H2,1-3H3,(H,18,22)(H,20,25) |
| InChIKey | TWAGHFIHTWRWHY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 81.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.34 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|