C17H20N2O4S — CID 56543406
methyl 3-[(2-butyl-4-methyl-1,3-thiazole-5-carbonyl)amino]-2-hydroxybenzoate (PubChem CID 56543406) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is methyl 3-[(2-butyl-4-methyl-1,3-thiazole-5-carbonyl)amino]-2-hydroxybenzoate.
| Compound Name | methyl 3-[(2-butyl-4-methyl-1,3-thiazole-5-carbonyl)amino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 56543406 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | methyl 3-[(2-butyl-4-methyl-1,3-thiazole-5-carbonyl)amino]-2-hydroxybenzoate |
| SMILES | CCCCc1nc(C)c(C(=O)Nc2cccc(C(=O)OC)c2O)s1 |
| InChI | InChI=1S/C17H20N2O4S/c1-4-5-9-13-18-10(2)15(24-13)16(21)19-12-8-6-7-11(14(12)20)17(22)23-3/h6-8,20H,4-5,9H2,1-3H3,(H,19,21) |
| InChIKey | YHURZXQHIHXMRD-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|