C21H24N2O7S — CID 56543449
methyl 2-hydroxy-3-[3-(4-morpholin-4-ylsulfonylphenyl)propanoylamino]benzoate (PubChem CID 56543449) has the molecular formula C21H24N2O7S and a molecular weight of 448.50 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[3-(4-morpholin-4-ylsulfonylphenyl)propanoylamino]benzoate.
| Compound Name | methyl 2-hydroxy-3-[3-(4-morpholin-4-ylsulfonylphenyl)propanoylamino]benzoate |
|---|---|
| PubChem CID | 56543449 |
| Molecular Formula | C21H24N2O7S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | methyl 2-hydroxy-3-[3-(4-morpholin-4-ylsulfonylphenyl)propanoylamino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CCc2ccc(S(=O)(=O)N3CCOCC3)cc2)c1O |
| InChI | InChI=1S/C21H24N2O7S/c1-29-21(26)17-3-2-4-18(20(17)25)22-19(24)10-7-15-5-8-16(9-6-15)31(27,28)23-11-13-30-14-12-23/h2-6,8-9,25H,7,10-14H2,1H3,(H,22,24) |
| InChIKey | PALCIJCVWIBZBH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|