C20H16F3N3O4 — CID 56543548
methyl 2-hydroxy-3-[[5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbonyl]amino]benzoate (PubChem CID 56543548) has the molecular formula C20H16F3N3O4 and a molecular weight of 419.36 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[[5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbonyl]amino]benzoate.
| Compound Name | methyl 2-hydroxy-3-[[5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 56543548 |
| Molecular Formula | C20H16F3N3O4 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | methyl 2-hydroxy-3-[[5-methyl-1-[3-(trifluoromethyl)phenyl]pyrazole-4-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2cnn(-c3cccc(C(F)(F)F)c3)c2C)c1O |
| InChI | InChI=1S/C20H16F3N3O4/c1-11-15(10-24-26(11)13-6-3-5-12(9-13)20(21,22)23)18(28)25-16-8-4-7-14(17(16)27)19(29)30-2/h3-10,27H,1-2H3,(H,25,28) |
| InChIKey | RSOKLRCNQBTGAM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|