C18H19N5O3S2 — CID 56544275
4-[methyl(phenyl)sulfamoyl]-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]benzamide (PubChem CID 56544275) has the molecular formula C18H19N5O3S2 and a molecular weight of 417.52 g/mol. Its IUPAC name is 4-[methyl(phenyl)sulfamoyl]-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]benzamide.
| Compound Name | 4-[methyl(phenyl)sulfamoyl]-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 56544275 |
| Molecular Formula | C18H19N5O3S2 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | 4-[methyl(phenyl)sulfamoyl]-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]benzamide |
| SMILES | CN(c1ccccc1)S(=O)(=O)c1ccc(C(=O)NCc2n[nH]c(=S)n2C)cc1 |
| InChI | InChI=1S/C18H19N5O3S2/c1-22-16(20-21-18(22)27)12-19-17(24)13-8-10-15(11-9-13)28(25,26)23(2)14-6-4-3-5-7-14/h3-11H,12H2,1-2H3,(H,19,24)(H,21,27) |
| InChIKey | ONWIYVWFHVNRJA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 100.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|