C22H33N3O4S — CID 56544721
1-[4-[4-(2-methylsulfonylethyl)piperazine-1-carbonyl]piperidin-1-yl]-3-phenylpropan-1-one (PubChem CID 56544721) has the molecular formula C22H33N3O4S and a molecular weight of 435.59 g/mol. Its IUPAC name is 1-[4-[4-(2-methylsulfonylethyl)piperazine-1-carbonyl]piperidin-1-yl]-3-phenylpropan-1-one.
| Compound Name | 1-[4-[4-(2-methylsulfonylethyl)piperazine-1-carbonyl]piperidin-1-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 56544721 |
| Molecular Formula | C22H33N3O4S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 1-[4-[4-(2-methylsulfonylethyl)piperazine-1-carbonyl]piperidin-1-yl]-3-phenylpropan-1-one |
| SMILES | CS(=O)(=O)CCN1CCN(C(=O)C2CCN(C(=O)CCc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C22H33N3O4S/c1-30(28,29)18-17-23-13-15-25(16-14-23)22(27)20-9-11-24(12-10-20)21(26)8-7-19-5-3-2-4-6-19/h2-6,20H,7-18H2,1H3 |
| InChIKey | PZFWCQKGJRMKNK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |