About N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]-N',N'-dipropylpentanediamide
N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]-N',N'-dipropylpentanediamide (PubChem CID 56545128) has the molecular formula C19H28N4O2S
and a molecular weight of 376.53 g/mol. Its IUPAC name is N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]-N',N'-dipropylpentanediamide.
Molecular Properties
| Compound Name | N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]-N',N'-dipropylpentanediamide |
| PubChem CID | 56545128 |
| Molecular Formula | C19H28N4O2S |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]-N',N'-dipropylpentanediamide |
| SMILES | CCCN(CCC)C(=O)CCCC(=O)Nc1cc(-c2ccc(C)s2)[nH]n1 |
| InChI | InChI=1S/C19H28N4O2S/c1-4-11-23(12-5-2)19(25)8-6-7-18(24)20-17-13-15(21-22-17)16-10-9-14(3)26-16/h9-10,13H,4-8,11-12H2,1-3H3,(H2,20,21,22,24) |
| InChIKey | VUARWONFSDVCNE-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]-N',N'-dipropylpentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]-N',N'-dipropylpentanediamide?
The IUPAC name of N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]-N',N'-dipropylpentanediamide (CID 56545128) is N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]-N',N'-dipropylpentanediamide.
What is the SMILES notation for N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]-N',N'-dipropylpentanediamide?
The canonical SMILES for N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]-N',N'-dipropylpentanediamide is CCCN(CCC)C(=O)CCCC(=O)Nc1cc(-c2ccc(C)s2)[nH]n1.
What is the InChIKey of N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]-N',N'-dipropylpentanediamide?
The InChIKey is VUARWONFSDVCNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N4O2S/c1-4-11-23(12-5-2)19(25)8-6-7-18(24)20-17-13-15(21-22-17)16-10-9-14(3)26-16/h9-10,13H,4-8,11-12H2,1-3H3,(H2,20,21,22,24).
What are the key properties of N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]-N',N'-dipropylpentanediamide?
N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]-N',N'-dipropylpentanediamide has a molecular weight of 376.53 g/mol, XLogP of 4.20, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(5-methylthiophen-2-yl)-1H-pyrazol-3-yl]-N',N'-dipropylpentanediamide is sourced from PubChem (CID 56545128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).