C22H20N4O4 — CID 56545663
N-[2-[[4-(4-carbamoylphenoxy)benzoyl]amino]ethyl]pyridine-3-carboxamide (PubChem CID 56545663) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is N-[2-[[4-(4-carbamoylphenoxy)benzoyl]amino]ethyl]pyridine-3-carboxamide.
| Compound Name | N-[2-[[4-(4-carbamoylphenoxy)benzoyl]amino]ethyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 56545663 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-[2-[[4-(4-carbamoylphenoxy)benzoyl]amino]ethyl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(Oc2ccc(C(=O)NCCNC(=O)c3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C22H20N4O4/c23-20(27)15-3-7-18(8-4-15)30-19-9-5-16(6-10-19)21(28)25-12-13-26-22(29)17-2-1-11-24-14-17/h1-11,14H,12-13H2,(H2,23,27)(H,25,28)(H,26,29) |
| InChIKey | BIMCWOVZKIWSLD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|