C19H25N5O3S2 — CID 56547026
N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)propanamide (PubChem CID 56547026) has the molecular formula C19H25N5O3S2 and a molecular weight of 435.58 g/mol. Its IUPAC name is N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)propanamide.
| Compound Name | N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 56547026 |
| Molecular Formula | C19H25N5O3S2 |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | N-[(4-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]-3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc2c(c1)CCCC2)NCc1n[nH]c(=S)n1C1CC1 |
| InChI | InChI=1S/C19H25N5O3S2/c25-18(20-12-17-22-23-19(28)24(17)15-6-7-15)9-10-21-29(26,27)16-8-5-13-3-1-2-4-14(13)11-16/h5,8,11,15,21H,1-4,6-7,9-10,12H2,(H,20,25)(H,23,28) |
| InChIKey | LYKGZBKWRRROCN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|