C23H26N4O3 — CID 56547470
(E)-3-(3-methoxy-4-propoxyphenyl)-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]prop-2-enamide (PubChem CID 56547470) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is (E)-3-(3-methoxy-4-propoxyphenyl)-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-methoxy-4-propoxyphenyl)-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 56547470 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (E)-3-(3-methoxy-4-propoxyphenyl)-N-[1-phenyl-2-(1,2,4-triazol-1-yl)ethyl]prop-2-enamide |
| SMILES | CCCOc1ccc(/C=C/C(=O)NC(Cn2cncn2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C23H26N4O3/c1-3-13-30-21-11-9-18(14-22(21)29-2)10-12-23(28)26-20(15-27-17-24-16-25-27)19-7-5-4-6-8-19/h4-12,14,16-17,20H,3,13,15H2,1-2H3,(H,26,28)/b12-10+ |
| InChIKey | MOYJPEDOOMMZEK-ZRDIBKRKSA-N |
| XLogP | 3.65 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|