C25H23N5O3 — CID 56548995
4-[4-[4-(3-cyano-2-pyridinyl)-1,4-diazepane-1-carbonyl]phenoxy]benzamide (PubChem CID 56548995) has the molecular formula C25H23N5O3 and a molecular weight of 441.49 g/mol. Its IUPAC name is 4-[4-[4-(3-cyano-2-pyridinyl)-1,4-diazepane-1-carbonyl]phenoxy]benzamide.
| Compound Name | 4-[4-[4-(3-cyano-2-pyridinyl)-1,4-diazepane-1-carbonyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 56548995 |
| Molecular Formula | C25H23N5O3 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 4-[4-[4-(3-cyano-2-pyridinyl)-1,4-diazepane-1-carbonyl]phenoxy]benzamide |
| SMILES | N#Cc1cccnc1N1CCCN(C(=O)c2ccc(Oc3ccc(C(N)=O)cc3)cc2)CC1 |
| InChI | InChI=1S/C25H23N5O3/c26-17-20-3-1-12-28-24(20)29-13-2-14-30(16-15-29)25(32)19-6-10-22(11-7-19)33-21-8-4-18(5-9-21)23(27)31/h1,3-12H,2,13-16H2,(H2,27,31) |
| InChIKey | YMYREEQNTXRHNT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |