C17H18BrN5O4 — CID 56549281
2-[[2-[(5-bromo-2-pyridinyl)amino]-2-oxoethyl]-methylamino]-N-(2-methyl-4-nitrophenyl)acetamide (PubChem CID 56549281) has the molecular formula C17H18BrN5O4 and a molecular weight of 436.27 g/mol. Its IUPAC name is 2-[[2-[(5-bromo-2-pyridinyl)amino]-2-oxoethyl]-methylamino]-N-(2-methyl-4-nitrophenyl)acetamide.
| Compound Name | 2-[[2-[(5-bromo-2-pyridinyl)amino]-2-oxoethyl]-methylamino]-N-(2-methyl-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 56549281 |
| Molecular Formula | C17H18BrN5O4 |
| Molecular Weight | 436.27 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 2-[[2-[(5-bromo-2-pyridinyl)amino]-2-oxoethyl]-methylamino]-N-(2-methyl-4-nitrophenyl)acetamide |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)CN(C)CC(=O)Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C17H18BrN5O4/c1-11-7-13(23(26)27)4-5-14(11)20-16(24)9-22(2)10-17(25)21-15-6-3-12(18)8-19-15/h3-8H,9-10H2,1-2H3,(H,20,24)(H,19,21,25) |
| InChIKey | FTFFUZFKPISCDF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 117.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|