C25H33N5O — CID 56550578
N-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)-4-[[ethyl(propan-2-yl)amino]methyl]benzamide (PubChem CID 56550578) has the molecular formula C25H33N5O and a molecular weight of 419.57 g/mol. Its IUPAC name is N-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)-4-[[ethyl(propan-2-yl)amino]methyl]benzamide.
| Compound Name | N-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)-4-[[ethyl(propan-2-yl)amino]methyl]benzamide |
|---|---|
| PubChem CID | 56550578 |
| Molecular Formula | C25H33N5O |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | N-(3-tert-butyl-1-pyridin-2-ylpyrazol-5-yl)-4-[[ethyl(propan-2-yl)amino]methyl]benzamide |
| SMILES | CCN(Cc1ccc(C(=O)Nc2cc(C(C)(C)C)nn2-c2ccccn2)cc1)C(C)C |
| InChI | InChI=1S/C25H33N5O/c1-7-29(18(2)3)17-19-11-13-20(14-12-19)24(31)27-23-16-21(25(4,5)6)28-30(23)22-10-8-9-15-26-22/h8-16,18H,7,17H2,1-6H3,(H,27,31) |
| InChIKey | CGHAFTKUCLOLPP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |