C24H29FN6O — CID 56550613
2-(4-fluorophenyl)-1-[4-[5-(5-phenyltetrazol-2-yl)pentyl]piperazin-1-yl]ethanone (PubChem CID 56550613) has the molecular formula C24H29FN6O and a molecular weight of 436.54 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-[4-[5-(5-phenyltetrazol-2-yl)pentyl]piperazin-1-yl]ethanone.
| Compound Name | 2-(4-fluorophenyl)-1-[4-[5-(5-phenyltetrazol-2-yl)pentyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 56550613 |
| Molecular Formula | C24H29FN6O |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 2-(4-fluorophenyl)-1-[4-[5-(5-phenyltetrazol-2-yl)pentyl]piperazin-1-yl]ethanone |
| SMILES | O=C(Cc1ccc(F)cc1)N1CCN(CCCCCn2nnc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C24H29FN6O/c25-22-11-9-20(10-12-22)19-23(32)30-17-15-29(16-18-30)13-5-2-6-14-31-27-24(26-28-31)21-7-3-1-4-8-21/h1,3-4,7-12H,2,5-6,13-19H2 |
| InChIKey | MDOZUPBJLYTZKB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|