C16H27N3O2 — CID 56550628
4-(1,3-dioxolan-2-yl)-1-(5-pyrazol-1-ylpentyl)piperidine (PubChem CID 56550628) has the molecular formula C16H27N3O2 and a molecular weight of 293.41 g/mol. Its IUPAC name is 4-(1,3-dioxolan-2-yl)-1-(5-pyrazol-1-ylpentyl)piperidine.
| Compound Name | 4-(1,3-dioxolan-2-yl)-1-(5-pyrazol-1-ylpentyl)piperidine |
|---|---|
| PubChem CID | 56550628 |
| Molecular Formula | C16H27N3O2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 4-(1,3-dioxolan-2-yl)-1-(5-pyrazol-1-ylpentyl)piperidine |
| SMILES | c1cnn(CCCCCN2CCC(C3OCCO3)CC2)c1 |
| InChI | InChI=1S/C16H27N3O2/c1(3-9-19-10-4-7-17-19)2-8-18-11-5-15(6-12-18)16-20-13-14-21-16/h4,7,10,15-16H,1-3,5-6,8-9,11-14H2 |
| InChIKey | MULPFRPLROCOFJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|