C22H27ClN2O3 — CID 56551881
2-(3-chlorophenoxy)-N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]propanamide (PubChem CID 56551881) has the molecular formula C22H27ClN2O3 and a molecular weight of 402.92 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]propanamide.
| Compound Name | 2-(3-chlorophenoxy)-N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 56551881 |
| Molecular Formula | C22H27ClN2O3 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-[[4-[(4-hydroxypiperidin-1-yl)methyl]phenyl]methyl]propanamide |
| SMILES | CC(Oc1cccc(Cl)c1)C(=O)NCc1ccc(CN2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C22H27ClN2O3/c1-16(28-21-4-2-3-19(23)13-21)22(27)24-14-17-5-7-18(8-6-17)15-25-11-9-20(26)10-12-25/h2-8,13,16,20,26H,9-12,14-15H2,1H3,(H,24,27) |
| InChIKey | OEZZYWQSUHUSBI-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |